C25H23F3N2O — CID 6173194
1-benzyl-1-[(E)-2-methyl-3-phenylprop-2-enyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 6173194) has the molecular formula C25H23F3N2O and a molecular weight of 424.47 g/mol. Its IUPAC name is 1-benzyl-1-[(E)-2-methyl-3-phenylprop-2-enyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-benzyl-1-[(E)-2-methyl-3-phenylprop-2-enyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 6173194 |
| Molecular Formula | C25H23F3N2O |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-benzyl-1-[(E)-2-methyl-3-phenylprop-2-enyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | C/C(=C\c1ccccc1)CN(Cc1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H23F3N2O/c1-19(15-20-9-4-2-5-10-20)17-30(18-21-11-6-3-7-12-21)24(31)29-23-14-8-13-22(16-23)25(26,27)28/h2-16H,17-18H2,1H3,(H,29,31)/b19-15+ |
| InChIKey | LCQYAGJCPYRSOO-XDJHFCHBSA-N |
| XLogP | 6.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |