C28H36F3N3O — CID 5139613
1-(2-benzylideneheptyl)-1-(piperidin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 5139613) has the molecular formula C28H36F3N3O and a molecular weight of 487.61 g/mol. Its IUPAC name is 1-(2-benzylideneheptyl)-1-(piperidin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-benzylideneheptyl)-1-(piperidin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 5139613 |
| Molecular Formula | C28H36F3N3O |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 1-(2-benzylideneheptyl)-1-(piperidin-4-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCCCCC(=Cc1ccccc1)CN(CC1CCNCC1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H36F3N3O/c1-2-3-5-11-24(18-22-9-6-4-7-10-22)21-34(20-23-14-16-32-17-15-23)27(35)33-26-13-8-12-25(19-26)28(29,30)31/h4,6-10,12-13,18-19,23,32H,2-3,5,11,14-17,20-21H2,1H3,(H,33,35) |
| InChIKey | YCAMZEZCQFDJGO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|