C31H38N2O — CID 3576994
1-(2-benzylideneheptyl)-3-(2,6-dimethylphenyl)-1-(2-phenylethyl)urea (PubChem CID 3576994) has the molecular formula C31H38N2O and a molecular weight of 454.66 g/mol. Its IUPAC name is 1-(2-benzylideneheptyl)-3-(2,6-dimethylphenyl)-1-(2-phenylethyl)urea.
| Compound Name | 1-(2-benzylideneheptyl)-3-(2,6-dimethylphenyl)-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 3576994 |
| Molecular Formula | C31H38N2O |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 1-(2-benzylideneheptyl)-3-(2,6-dimethylphenyl)-1-(2-phenylethyl)urea |
| SMILES | CCCCCC(=Cc1ccccc1)CN(CCc1ccccc1)C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C31H38N2O/c1-4-5-8-20-29(23-28-18-11-7-12-19-28)24-33(22-21-27-16-9-6-10-17-27)31(34)32-30-25(2)14-13-15-26(30)3/h6-7,9-19,23H,4-5,8,20-22,24H2,1-3H3,(H,32,34) |
| InChIKey | WFRLUDXNLCZTJV-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|