C29H31Cl2NO — CID 42703257
N-[(2E)-2-benzylideneheptyl]-3,4-dichloro-N-(2-phenylethyl)benzamide (PubChem CID 42703257) has the molecular formula C29H31Cl2NO and a molecular weight of 480.48 g/mol. Its IUPAC name is N-[(2E)-2-benzylideneheptyl]-3,4-dichloro-N-(2-phenylethyl)benzamide.
| Compound Name | N-[(2E)-2-benzylideneheptyl]-3,4-dichloro-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42703257 |
| Molecular Formula | C29H31Cl2NO |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-[(2E)-2-benzylideneheptyl]-3,4-dichloro-N-(2-phenylethyl)benzamide |
| SMILES | CCCCC/C(=C\c1ccccc1)CN(CCc1ccccc1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H31Cl2NO/c1-2-3-6-15-25(20-24-13-9-5-10-14-24)22-32(19-18-23-11-7-4-8-12-23)29(33)26-16-17-27(30)28(31)21-26/h4-5,7-14,16-17,20-21H,2-3,6,15,18-19,22H2,1H3/b25-20+ |
| InChIKey | YPDBBNUJNYTPNN-LKUDQCMESA-N |
| XLogP | 8.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|