C28H32Cl2N2O4 — CID 4645321
3,4-dichloro-N-(3-ethoxypropyl)-N-[2-[(5-methylfuran-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl]benzamide (PubChem CID 4645321) has the molecular formula C28H32Cl2N2O4 and a molecular weight of 531.48 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-ethoxypropyl)-N-[2-[(5-methylfuran-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-(3-ethoxypropyl)-N-[2-[(5-methylfuran-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4645321 |
| Molecular Formula | C28H32Cl2N2O4 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 3,4-dichloro-N-(3-ethoxypropyl)-N-[2-[(5-methylfuran-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl]benzamide |
| SMILES | CCOCCCN(CC(=O)N(CCc1ccccc1)Cc1ccc(C)o1)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H32Cl2N2O4/c1-3-35-17-7-15-32(28(34)23-11-13-25(29)26(30)18-23)20-27(33)31(19-24-12-10-21(2)36-24)16-14-22-8-5-4-6-9-22/h4-6,8-13,18H,3,7,14-17,19-20H2,1-2H3 |
| InChIKey | GLYRPNXYZRICGS-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|