C26H36N2O6 — CID 4547725
ethyl 4-[[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-(3-ethoxypropyl)amino]-4-oxobutanoate (PubChem CID 4547725) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is ethyl 4-[[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-(3-ethoxypropyl)amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-(3-ethoxypropyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4547725 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | ethyl 4-[[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-(3-ethoxypropyl)amino]-4-oxobutanoate |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)o1)C(=O)CCC(=O)OCC |
| InChI | InChI=1S/C26H36N2O6/c1-4-32-17-9-16-27(24(29)14-15-26(31)33-5-2)20-25(30)28(18-22-10-7-6-8-11-22)19-23-13-12-21(3)34-23/h6-8,10-13H,4-5,9,14-20H2,1-3H3 |
| InChIKey | TXJQSPOGYPKULD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|