C29H36N2O5 — CID 42773091
N-benzyl-2-[3-ethoxypropyl-(2-phenylmethoxyacetyl)amino]-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 42773091) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is N-benzyl-2-[3-ethoxypropyl-(2-phenylmethoxyacetyl)amino]-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[3-ethoxypropyl-(2-phenylmethoxyacetyl)amino]-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 42773091 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | N-benzyl-2-[3-ethoxypropyl-(2-phenylmethoxyacetyl)amino]-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)o1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C29H36N2O5/c1-3-34-18-10-17-30(29(33)23-35-22-26-13-8-5-9-14-26)21-28(32)31(19-25-11-6-4-7-12-25)20-27-16-15-24(2)36-27/h4-9,11-16H,3,10,17-23H2,1-2H3 |
| InChIKey | MVVNUPDVUSGSCT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|