C25H30N2O5 — CID 42773085
N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)furan-2-carboxamide (PubChem CID 42773085) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)furan-2-carboxamide.
| Compound Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42773085 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(3-ethoxypropyl)furan-2-carboxamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)o1)C(=O)c1ccco1 |
| InChI | InChI=1S/C25H30N2O5/c1-3-30-15-8-14-26(25(29)23-11-7-16-31-23)19-24(28)27(17-21-9-5-4-6-10-21)18-22-13-12-20(2)32-22/h4-7,9-13,16H,3,8,14-15,17-19H2,1-2H3 |
| InChIKey | AKBCQMMXJVEAIC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|