C27H31FN2O4 — CID 4284944
4-fluoro-N-(3-methoxypropyl)-N-[2-[(5-methylfuran-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl]benzamide (PubChem CID 4284944) has the molecular formula C27H31FN2O4 and a molecular weight of 466.55 g/mol. Its IUPAC name is 4-fluoro-N-(3-methoxypropyl)-N-[2-[(5-methylfuran-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-fluoro-N-(3-methoxypropyl)-N-[2-[(5-methylfuran-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4284944 |
| Molecular Formula | C27H31FN2O4 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 4-fluoro-N-(3-methoxypropyl)-N-[2-[(5-methylfuran-2-yl)methyl-(2-phenylethyl)amino]-2-oxoethyl]benzamide |
| SMILES | COCCCN(CC(=O)N(CCc1ccccc1)Cc1ccc(C)o1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H31FN2O4/c1-21-9-14-25(34-21)19-29(17-15-22-7-4-3-5-8-22)26(31)20-30(16-6-18-33-2)27(32)23-10-12-24(28)13-11-23/h3-5,7-14H,6,15-20H2,1-2H3 |
| InChIKey | XLDKOIQCWVTNBK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|