C22H26Cl2N2O2 — CID 67935907
N-butyl-N'-(4-butylbenzoyl)-3,4-dichlorobenzohydrazide (PubChem CID 67935907) has the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.37 g/mol. Its IUPAC name is N-butyl-N'-(4-butylbenzoyl)-3,4-dichlorobenzohydrazide.
| Compound Name | N-butyl-N'-(4-butylbenzoyl)-3,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 67935907 |
| Molecular Formula | C22H26Cl2N2O2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-butyl-N'-(4-butylbenzoyl)-3,4-dichlorobenzohydrazide |
| SMILES | CCCCc1ccc(C(=O)NN(CCCC)C(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H26Cl2N2O2/c1-3-5-7-16-8-10-17(11-9-16)21(27)25-26(14-6-4-2)22(28)18-12-13-19(23)20(24)15-18/h8-13,15H,3-7,14H2,1-2H3,(H,25,27) |
| InChIKey | PSEZSPAFWWIBIL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|