C18H27Cl2N3O — CID 155350283
N-[(3E)-3-[butyl(methyl)hydrazinylidene]pentyl]-3,4-dichloro-N-methylbenzamide (PubChem CID 155350283) has the molecular formula C18H27Cl2N3O and a molecular weight of 372.34 g/mol. Its IUPAC name is N-[(3E)-3-[butyl(methyl)hydrazinylidene]pentyl]-3,4-dichloro-N-methylbenzamide.
| Compound Name | N-[(3E)-3-[butyl(methyl)hydrazinylidene]pentyl]-3,4-dichloro-N-methylbenzamide |
|---|---|
| PubChem CID | 155350283 |
| Molecular Formula | C18H27Cl2N3O |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[(3E)-3-[butyl(methyl)hydrazinylidene]pentyl]-3,4-dichloro-N-methylbenzamide |
| SMILES | CCCCN(C)/N=C(\CC)CCN(C)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H27Cl2N3O/c1-5-7-11-23(4)21-15(6-2)10-12-22(3)18(24)14-8-9-16(19)17(20)13-14/h8-9,13H,5-7,10-12H2,1-4H3/b21-15+ |
| InChIKey | CNYGKQGNBZIDOP-RCCKNPSSSA-N |
| XLogP | 4.95 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|