C19H28Cl2N2O5 — CID 21409840
3,4-dichloro-N-[2-(dimethylamino)-2-methylhexyl]-N-methylbenzamide;oxalic acid (PubChem CID 21409840) has the molecular formula C19H28Cl2N2O5 and a molecular weight of 435.35 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(dimethylamino)-2-methylhexyl]-N-methylbenzamide;oxalic acid.
| Compound Name | 3,4-dichloro-N-[2-(dimethylamino)-2-methylhexyl]-N-methylbenzamide;oxalic acid |
|---|---|
| PubChem CID | 21409840 |
| Molecular Formula | C19H28Cl2N2O5 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3,4-dichloro-N-[2-(dimethylamino)-2-methylhexyl]-N-methylbenzamide;oxalic acid |
| SMILES | CCCCC(C)(CN(C)C(=O)c1ccc(Cl)c(Cl)c1)N(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H26Cl2N2O.C2H2O4/c1-6-7-10-17(2,20(3)4)12-21(5)16(22)13-8-9-14(18)15(19)11-13;3-1(4)2(5)6/h8-9,11H,6-7,10,12H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | ROPCJXDWTHHMGZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|