C12H12Cl2N2O — CID 94697054
3,4-dichloro-N-(2-cyanopropan-2-yl)-N-methylbenzamide (PubChem CID 94697054) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-cyanopropan-2-yl)-N-methylbenzamide.
| Compound Name | 3,4-dichloro-N-(2-cyanopropan-2-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 94697054 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3,4-dichloro-N-(2-cyanopropan-2-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)c(Cl)c1)C(C)(C)C#N |
| InChI | InChI=1S/C12H12Cl2N2O/c1-12(2,7-15)16(3)11(17)8-4-5-9(13)10(14)6-8/h4-6H,1-3H3 |
| InChIKey | RUIUIHKXTAXAQR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |