About 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide
4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide (PubChem CID 176768221) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide.
Molecular Properties
| Compound Name | 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide |
| PubChem CID | 176768221 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide |
| SMILES | CCCN(NC(=O)c1ccc(O)cc1)C(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-2-11-19(17(23)13-5-9-15(21)10-6-13)18-16(22)12-3-7-14(20)8-4-12/h3-10,20-21H,2,11H2,1H3,(H,18,22) |
| InChIKey | GGSASLOMKDNYLL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide?
The IUPAC name of 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide (CID 176768221) is 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide.
What is the SMILES notation for 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide?
The canonical SMILES for 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide is CCCN(NC(=O)c1ccc(O)cc1)C(=O)c1ccc(O)cc1.
What is the InChIKey of 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide?
The InChIKey is GGSASLOMKDNYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4/c1-2-11-19(17(23)13-5-9-15(21)10-6-13)18-16(22)12-3-7-14(20)8-4-12/h3-10,20-21H,2,11H2,1H3,(H,18,22).
What are the key properties of 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide?
4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide has a molecular weight of 314.34 g/mol, XLogP of 2.30, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N'-(4-hydroxybenzoyl)-N'-propylbenzohydrazide is sourced from PubChem (CID 176768221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).