C22H26N2O5 — CID 168796424
4-[4-[[(2-methylpropan-2-yl)oxycarbonyl-propylamino]carbamoyl]phenyl]benzoic acid (PubChem CID 168796424) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-[4-[[(2-methylpropan-2-yl)oxycarbonyl-propylamino]carbamoyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[[(2-methylpropan-2-yl)oxycarbonyl-propylamino]carbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 168796424 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[4-[[(2-methylpropan-2-yl)oxycarbonyl-propylamino]carbamoyl]phenyl]benzoic acid |
| SMILES | CCCN(NC(=O)c1ccc(-c2ccc(C(=O)O)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26N2O5/c1-5-14-24(21(28)29-22(2,3)4)23-19(25)17-10-6-15(7-11-17)16-8-12-18(13-9-16)20(26)27/h6-13H,5,14H2,1-4H3,(H,23,25)(H,26,27) |
| InChIKey | XZFQNOCXAXCOOT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|