C19H27N3O7 — CID 58135237
2-[N-(carboxymethyl)-5-[[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]-2-methylanilino]acetic acid (PubChem CID 58135237) has the molecular formula C19H27N3O7 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[N-(carboxymethyl)-5-[[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]-2-methylanilino]acetic acid.
| Compound Name | 2-[N-(carboxymethyl)-5-[[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]-2-methylanilino]acetic acid |
|---|---|
| PubChem CID | 58135237 |
| Molecular Formula | C19H27N3O7 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[N-(carboxymethyl)-5-[[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]-2-methylanilino]acetic acid |
| SMILES | CCN(NC(=O)c1ccc(C)c(N(CC(=O)O)CC(=O)O)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27N3O7/c1-6-22(18(28)29-19(3,4)5)20-17(27)13-8-7-12(2)14(9-13)21(10-15(23)24)11-16(25)26/h7-9H,6,10-11H2,1-5H3,(H,20,27)(H,23,24)(H,25,26) |
| InChIKey | JFBRYICOZFLHQI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|