C18H30N2O2 — CID 102569860
tert-butyl N-methyl-N-[1-[4-methyl-3-(propylamino)phenyl]ethyl]carbamate (PubChem CID 102569860) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-[4-methyl-3-(propylamino)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-[4-methyl-3-(propylamino)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 102569860 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | tert-butyl N-methyl-N-[1-[4-methyl-3-(propylamino)phenyl]ethyl]carbamate |
| SMILES | CCCNc1cc(C(C)N(C)C(=O)OC(C)(C)C)ccc1C |
| InChI | InChI=1S/C18H30N2O2/c1-8-11-19-16-12-15(10-9-13(16)2)14(3)20(7)17(21)22-18(4,5)6/h9-10,12,14,19H,8,11H2,1-7H3 |
| InChIKey | DZKLOFZAWFGPMP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |