C30H37N5O8 — CID 87361320
tert-butyl N-[3-(hydroxyamino)-3-oxopropyl]-N-[[4-[2-[4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]phenyl]ethynyl]benzoyl]amino]carbamate (PubChem CID 87361320) has the molecular formula C30H37N5O8 and a molecular weight of 595.65 g/mol. Its IUPAC name is tert-butyl N-[3-(hydroxyamino)-3-oxopropyl]-N-[[4-[2-[4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]phenyl]ethynyl]benzoyl]amino]carbamate.
| Compound Name | tert-butyl N-[3-(hydroxyamino)-3-oxopropyl]-N-[[4-[2-[4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]phenyl]ethynyl]benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 87361320 |
| Molecular Formula | C30H37N5O8 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | tert-butyl N-[3-(hydroxyamino)-3-oxopropyl]-N-[[4-[2-[4-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]phenyl]ethynyl]benzoyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccc(C#Cc2ccc(C(=O)NN(CCC(=O)NO)C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H37N5O8/c1-29(2,3)42-27(39)31-19-25(37)32-23-15-11-21(12-16-23)8-7-20-9-13-22(14-10-20)26(38)33-35(18-17-24(36)34-41)28(40)43-30(4,5)6/h9-16,41H,17-19H2,1-6H3,(H,31,39)(H,32,37)(H,33,38)(H,34,36) |
| InChIKey | SAYXREIUPHDJSZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 175.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|