C18H25N3O4 — CID 108917066
tert-butyl N-[2-oxo-2-[4-[[(E)-pent-2-enoyl]amino]anilino]ethyl]carbamate (PubChem CID 108917066) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[4-[[(E)-pent-2-enoyl]amino]anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[4-[[(E)-pent-2-enoyl]amino]anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 108917066 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[4-[[(E)-pent-2-enoyl]amino]anilino]ethyl]carbamate |
| SMILES | CC/C=C/C(=O)Nc1ccc(NC(=O)CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-5-6-7-15(22)20-13-8-10-14(11-9-13)21-16(23)12-19-17(24)25-18(2,3)4/h6-11H,5,12H2,1-4H3,(H,19,24)(H,20,22)(H,21,23)/b7-6+ |
| InChIKey | PRBBGVRHDUWFQG-VOTSOKGWSA-N |
| XLogP | 3.05 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|