C36H49N5O7S — CID 178102356
tert-butyl N-[[4-[[(3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamoyl]benzoyl]amino]-N-propylcarbamate (PubChem CID 178102356) has the molecular formula C36H49N5O7S and a molecular weight of 695.88 g/mol. Its IUPAC name is tert-butyl N-[[4-[[(3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamoyl]benzoyl]amino]-N-propylcarbamate.
| Compound Name | tert-butyl N-[[4-[[(3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamoyl]benzoyl]amino]-N-propylcarbamate |
|---|---|
| PubChem CID | 178102356 |
| Molecular Formula | C36H49N5O7S |
| Molecular Weight | 695.88 g/mol |
| Exact Mass | 695.34 |
| IUPAC Name | tert-butyl N-[[4-[[(3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamoyl]benzoyl]amino]-N-propylcarbamate |
| SMILES | CCCN(NC(=O)c1ccc(C(=O)NC(Cc2ccccc2)[C@H](O)CN(CC(C)C)S(=O)(=O)c2ccc(N)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H49N5O7S/c1-7-21-41(35(45)48-36(4,5)6)39-34(44)28-15-13-27(14-16-28)33(43)38-31(22-26-11-9-8-10-12-26)32(42)24-40(23-25(2)3)49(46,47)30-19-17-29(37)18-20-30/h8-20,25,31-32,42H,7,21-24,37H2,1-6H3,(H,38,43)(H,39,44)/t31?,32-/m1/s1 |
| InChIKey | CNGSTBUXSZZGJF-IADGFXSZSA-N |
| XLogP | 4.61 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.88 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|