C29H49N3O6S — CID 142066892
butane;ethane;methoxymethyl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 142066892) has the molecular formula C29H49N3O6S and a molecular weight of 567.79 g/mol. Its IUPAC name is butane;ethane;methoxymethyl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | butane;ethane;methoxymethyl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142066892 |
| Molecular Formula | C29H49N3O6S |
| Molecular Weight | 567.79 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | butane;ethane;methoxymethyl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CC.CCCC.COCOC(=O)NC(Cc1ccccc1)C(O)CN(CC(C)C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C23H33N3O6S.C4H10.C2H6/c1-17(2)14-26(33(29,30)20-11-9-19(24)10-12-20)15-22(27)21(25-23(28)32-16-31-3)13-18-7-5-4-6-8-18;1-3-4-2;1-2/h4-12,17,21-22,27H,13-16,24H2,1-3H3,(H,25,28);3-4H2,1-2H3;1-2H3 |
| InChIKey | AZOKHROUGBJXQT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|