C21H32N4O3S — CID 172877336
4-amino-N-[(2R,3S)-2-hydroxy-3-(2-methylhydrazinyl)-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 172877336) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is 4-amino-N-[(2R,3S)-2-hydroxy-3-(2-methylhydrazinyl)-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-amino-N-[(2R,3S)-2-hydroxy-3-(2-methylhydrazinyl)-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 172877336 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 4-amino-N-[(2R,3S)-2-hydroxy-3-(2-methylhydrazinyl)-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CNN[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C21H32N4O3S/c1-16(2)14-25(29(27,28)19-11-9-18(22)10-12-19)15-21(26)20(24-23-3)13-17-7-5-4-6-8-17/h4-12,16,20-21,23-24,26H,13-15,22H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | DFOOPAGIXOQUHO-LEWJYISDSA-N |
| XLogP | 1.61 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|