C27H33N3O6S — CID 176513917
N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-3,4-dihydroxybenzamide (PubChem CID 176513917) has the molecular formula C27H33N3O6S and a molecular weight of 527.64 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-3,4-dihydroxybenzamide.
| Compound Name | N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 176513917 |
| Molecular Formula | C27H33N3O6S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-3,4-dihydroxybenzamide |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)c1ccc(O)c(O)c1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C27H33N3O6S/c1-18(2)16-30(37(35,36)22-11-9-21(28)10-12-22)17-26(33)23(14-19-6-4-3-5-7-19)29-27(34)20-8-13-24(31)25(32)15-20/h3-13,15,18,23,26,31-33H,14,16-17,28H2,1-2H3,(H,29,34)/t23-,26+/m0/s1 |
| InChIKey | UCHRNBQHYTVSTP-JYFHCDHNSA-N |
| XLogP | 2.73 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|