C28H35N3O7S — CID 54539191
(1-oxidopyridin-1-ium-3-yl)methyl N-[(2S)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 54539191) has the molecular formula C28H35N3O7S and a molecular weight of 557.67 g/mol. Its IUPAC name is (1-oxidopyridin-1-ium-3-yl)methyl N-[(2S)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | (1-oxidopyridin-1-ium-3-yl)methyl N-[(2S)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 54539191 |
| Molecular Formula | C28H35N3O7S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (1-oxidopyridin-1-ium-3-yl)methyl N-[(2S)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)CC(O)[C@H](Cc2ccccc2)NC(=O)OCc2ccc[n+]([O-])c2)cc1 |
| InChI | InChI=1S/C28H35N3O7S/c1-21(2)17-31(39(35,36)25-13-11-24(37-3)12-14-25)19-27(32)26(16-22-8-5-4-6-9-22)29-28(33)38-20-23-10-7-15-30(34)18-23/h4-15,18,21,26-27,32H,16-17,19-20H2,1-3H3,(H,29,33)/t26-,27?/m0/s1 |
| InChIKey | ZBXOSPKPSJHTDL-QBHOUYDASA-N |
| XLogP | 2.87 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|