C29H37N3O6S — CID 54029840
(1-methanidylpyridin-1-ium-4-yl)methyl N-[(2S)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 54029840) has the molecular formula C29H37N3O6S and a molecular weight of 555.70 g/mol. Its IUPAC name is (1-methanidylpyridin-1-ium-4-yl)methyl N-[(2S)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | (1-methanidylpyridin-1-ium-4-yl)methyl N-[(2S)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 54029840 |
| Molecular Formula | C29H37N3O6S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | (1-methanidylpyridin-1-ium-4-yl)methyl N-[(2S)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | [CH2-][n+]1ccc(COC(=O)N[C@@H](Cc2ccccc2)C(O)CN(CC(C)C)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H37N3O6S/c1-22(2)19-32(39(35,36)26-12-10-25(37-4)11-13-26)20-28(33)27(18-23-8-6-5-7-9-23)30-29(34)38-21-24-14-16-31(3)17-15-24/h5-17,22,27-28,33H,3,18-21H2,1-2,4H3,(H,30,34)/t27-,28?/m0/s1 |
| InChIKey | LEULKXOWNDMHFJ-MBMZGMDYSA-N |
| XLogP | 3.17 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|