C33H33F6N3O — CID 3963616
1-(2-benzylideneheptyl)-3-[3,5-bis(trifluoromethyl)phenyl]-1-[2-(1H-indol-3-yl)ethyl]urea (PubChem CID 3963616) has the molecular formula C33H33F6N3O and a molecular weight of 601.64 g/mol. Its IUPAC name is 1-(2-benzylideneheptyl)-3-[3,5-bis(trifluoromethyl)phenyl]-1-[2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-(2-benzylideneheptyl)-3-[3,5-bis(trifluoromethyl)phenyl]-1-[2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 3963616 |
| Molecular Formula | C33H33F6N3O |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 1-(2-benzylideneheptyl)-3-[3,5-bis(trifluoromethyl)phenyl]-1-[2-(1H-indol-3-yl)ethyl]urea |
| SMILES | CCCCCC(=Cc1ccccc1)CN(CCc1c[nH]c2ccccc12)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H33F6N3O/c1-2-3-5-12-24(17-23-10-6-4-7-11-23)22-42(16-15-25-21-40-30-14-9-8-13-29(25)30)31(43)41-28-19-26(32(34,35)36)18-27(20-28)33(37,38)39/h4,6-11,13-14,17-21,40H,2-3,5,12,15-16,22H2,1H3,(H,41,43) |
| InChIKey | XSYFMSDOLORTKD-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|