C24H28N2O — CID 42697546
N-[2-(1H-indol-3-yl)ethyl]-N-[(E)-2-methyl-3-phenylprop-2-enyl]butanamide (PubChem CID 42697546) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N-[(E)-2-methyl-3-phenylprop-2-enyl]butanamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N-[(E)-2-methyl-3-phenylprop-2-enyl]butanamide |
|---|---|
| PubChem CID | 42697546 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N-[(E)-2-methyl-3-phenylprop-2-enyl]butanamide |
| SMILES | CCCC(=O)N(CCc1c[nH]c2ccccc12)C/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C24H28N2O/c1-3-9-24(27)26(18-19(2)16-20-10-5-4-6-11-20)15-14-21-17-25-23-13-8-7-12-22(21)23/h4-8,10-13,16-17,25H,3,9,14-15,18H2,1-2H3/b19-16+ |
| InChIKey | LJQIBOLNHUUKTR-KNTRCKAVSA-N |
| XLogP | 5.44 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |