C18H24N2O3 — CID 23336475
methyl 5-[ethyl-[2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoate (PubChem CID 23336475) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 5-[ethyl-[2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoate.
| Compound Name | methyl 5-[ethyl-[2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 23336475 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | methyl 5-[ethyl-[2-(1H-indol-3-yl)ethyl]amino]-5-oxopentanoate |
| SMILES | CCN(CCc1c[nH]c2ccccc12)C(=O)CCCC(=O)OC |
| InChI | InChI=1S/C18H24N2O3/c1-3-20(17(21)9-6-10-18(22)23-2)12-11-14-13-19-16-8-5-4-7-15(14)16/h4-5,7-8,13,19H,3,6,9-12H2,1-2H3 |
| InChIKey | ROIYBKFWNSEUAQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |