C24H28N2O3 — CID 9416154
[(1S)-2-(diethylamino)-2-oxo-1-phenylethyl] 4-(1H-indol-3-yl)butanoate (PubChem CID 9416154) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is [(1S)-2-(diethylamino)-2-oxo-1-phenylethyl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [(1S)-2-(diethylamino)-2-oxo-1-phenylethyl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 9416154 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | [(1S)-2-(diethylamino)-2-oxo-1-phenylethyl] 4-(1H-indol-3-yl)butanoate |
| SMILES | CCN(CC)C(=O)[C@@H](OC(=O)CCCc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c1-3-26(4-2)24(28)23(18-11-6-5-7-12-18)29-22(27)16-10-13-19-17-25-21-15-9-8-14-20(19)21/h5-9,11-12,14-15,17,23,25H,3-4,10,13,16H2,1-2H3/t23-/m0/s1 |
| InChIKey | WMLMVEXDCFLSEG-QHCPKHFHSA-N |
| XLogP | 4.64 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |