C24H26N2O3 — CID 78837535
N-[[4-(dimethylamino)phenyl]methyl]-2-(4-hydroxyphenyl)-N-(4-methoxyphenyl)acetamide (PubChem CID 78837535) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(4-hydroxyphenyl)-N-(4-methoxyphenyl)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(4-hydroxyphenyl)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 78837535 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(4-hydroxyphenyl)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(N(Cc2ccc(N(C)C)cc2)C(=O)Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-25(2)20-8-4-19(5-9-20)17-26(21-10-14-23(29-3)15-11-21)24(28)16-18-6-12-22(27)13-7-18/h4-15,27H,16-17H2,1-3H3 |
| InChIKey | PTBDYQNQMAUGKG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|