C41H45N5O4 — CID 164739686
3-N,5-N-bis[[4-(dimethylamino)phenyl]methyl]-3-N,5-N-bis[(4-methoxyphenyl)methyl]pyridine-3,5-dicarboxamide (PubChem CID 164739686) has the molecular formula C41H45N5O4 and a molecular weight of 671.84 g/mol. Its IUPAC name is 3-N,5-N-bis[[4-(dimethylamino)phenyl]methyl]-3-N,5-N-bis[(4-methoxyphenyl)methyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[[4-(dimethylamino)phenyl]methyl]-3-N,5-N-bis[(4-methoxyphenyl)methyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 164739686 |
| Molecular Formula | C41H45N5O4 |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.35 |
| IUPAC Name | 3-N,5-N-bis[[4-(dimethylamino)phenyl]methyl]-3-N,5-N-bis[(4-methoxyphenyl)methyl]pyridine-3,5-dicarboxamide |
| SMILES | COc1ccc(CN(Cc2ccc(N(C)C)cc2)C(=O)c2cncc(C(=O)N(Cc3ccc(OC)cc3)Cc3ccc(N(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C41H45N5O4/c1-43(2)36-15-7-30(8-16-36)26-45(28-32-11-19-38(49-5)20-12-32)40(47)34-23-35(25-42-24-34)41(48)46(29-33-13-21-39(50-6)22-14-33)27-31-9-17-37(18-10-31)44(3)4/h7-25H,26-29H2,1-6H3 |
| InChIKey | DIQZPWISYOCDOZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 78.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|