C29H26O3S2 — CID 70031381
2-phenylsulfanyl-3-[4-[2-(4-phenylsulfanylphenyl)ethoxy]phenyl]propanoic acid (PubChem CID 70031381) has the molecular formula C29H26O3S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 2-phenylsulfanyl-3-[4-[2-(4-phenylsulfanylphenyl)ethoxy]phenyl]propanoic acid.
| Compound Name | 2-phenylsulfanyl-3-[4-[2-(4-phenylsulfanylphenyl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70031381 |
| Molecular Formula | C29H26O3S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 2-phenylsulfanyl-3-[4-[2-(4-phenylsulfanylphenyl)ethoxy]phenyl]propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(OCCc2ccc(Sc3ccccc3)cc2)cc1)Sc1ccccc1 |
| InChI | InChI=1S/C29H26O3S2/c30-29(31)28(34-26-9-5-2-6-10-26)21-23-11-15-24(16-12-23)32-20-19-22-13-17-27(18-14-22)33-25-7-3-1-4-8-25/h1-18,28H,19-21H2,(H,30,31) |
| InChIKey | ZLXSKHVRGJGRRS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |