C21H17ClO3S — CID 133241111
2-(4-chlorophenyl)sulfanyl-3-(4-phenoxyphenyl)propanoic acid (PubChem CID 133241111) has the molecular formula C21H17ClO3S and a molecular weight of 384.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-3-(4-phenoxyphenyl)propanoic acid.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-3-(4-phenoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 133241111 |
| Molecular Formula | C21H17ClO3S |
| Molecular Weight | 384.88 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-3-(4-phenoxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Oc2ccccc2)cc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClO3S/c22-16-8-12-19(13-9-16)26-20(21(23)24)14-15-6-10-18(11-7-15)25-17-4-2-1-3-5-17/h1-13,20H,14H2,(H,23,24) |
| InChIKey | DZGKWLNDJXZSIK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.88 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |