C15H12Cl2O2S — CID 133245393
3-(4-chlorophenyl)-2-(4-chlorophenyl)sulfanylpropanoic acid (PubChem CID 133245393) has the molecular formula C15H12Cl2O2S and a molecular weight of 327.23 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(4-chlorophenyl)sulfanylpropanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-(4-chlorophenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 133245393 |
| Molecular Formula | C15H12Cl2O2S |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(4-chlorophenyl)sulfanylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Cl)cc1)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2O2S/c16-11-3-1-10(2-4-11)9-14(15(18)19)20-13-7-5-12(17)6-8-13/h1-8,14H,9H2,(H,18,19) |
| InChIKey | NTKVBUORQIBWHU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |