C16H15BrO2S — CID 100535533
(2R)-3-(4-bromophenyl)-2-(4-methylphenyl)sulfanylpropanoic acid (PubChem CID 100535533) has the molecular formula C16H15BrO2S and a molecular weight of 351.27 g/mol. Its IUPAC name is (2R)-3-(4-bromophenyl)-2-(4-methylphenyl)sulfanylpropanoic acid.
| Compound Name | (2R)-3-(4-bromophenyl)-2-(4-methylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 100535533 |
| Molecular Formula | C16H15BrO2S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | (2R)-3-(4-bromophenyl)-2-(4-methylphenyl)sulfanylpropanoic acid |
| SMILES | Cc1ccc(S[C@H](Cc2ccc(Br)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H15BrO2S/c1-11-2-8-14(9-3-11)20-15(16(18)19)10-12-4-6-13(17)7-5-12/h2-9,15H,10H2,1H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | ITRCSGJVWVJHBX-OAHLLOKOSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |