C17H17ClO2S — CID 100530642
(2S)-2-(4-chlorophenyl)sulfanyl-3-(4-ethylphenyl)propanoic acid (PubChem CID 100530642) has the molecular formula C17H17ClO2S and a molecular weight of 320.84 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)sulfanyl-3-(4-ethylphenyl)propanoic acid.
| Compound Name | (2S)-2-(4-chlorophenyl)sulfanyl-3-(4-ethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100530642 |
| Molecular Formula | C17H17ClO2S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)sulfanyl-3-(4-ethylphenyl)propanoic acid |
| SMILES | CCc1ccc(C[C@H](Sc2ccc(Cl)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H17ClO2S/c1-2-12-3-5-13(6-4-12)11-16(17(19)20)21-15-9-7-14(18)8-10-15/h3-10,16H,2,11H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | VRPMYOCQNSJMJT-INIZCTEOSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |