C16H14Cl2O2S — CID 133245513
3-(4-chloro-2-methylphenyl)-2-(4-chlorophenyl)sulfanylpropanoic acid (PubChem CID 133245513) has the molecular formula C16H14Cl2O2S and a molecular weight of 341.26 g/mol. Its IUPAC name is 3-(4-chloro-2-methylphenyl)-2-(4-chlorophenyl)sulfanylpropanoic acid.
| Compound Name | 3-(4-chloro-2-methylphenyl)-2-(4-chlorophenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 133245513 |
| Molecular Formula | C16H14Cl2O2S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 3-(4-chloro-2-methylphenyl)-2-(4-chlorophenyl)sulfanylpropanoic acid |
| SMILES | Cc1cc(Cl)ccc1CC(Sc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H14Cl2O2S/c1-10-8-13(18)3-2-11(10)9-15(16(19)20)21-14-6-4-12(17)5-7-14/h2-8,15H,9H2,1H3,(H,19,20) |
| InChIKey | ZLKIEVKHWZQEDE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |