C17H17ClO4S — CID 133241169
2-(4-chlorophenyl)sulfanyl-3-(2,5-dimethoxyphenyl)propanoic acid (PubChem CID 133241169) has the molecular formula C17H17ClO4S and a molecular weight of 352.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-3-(2,5-dimethoxyphenyl)propanoic acid.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-3-(2,5-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 133241169 |
| Molecular Formula | C17H17ClO4S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-3-(2,5-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(OC)c(CC(Sc2ccc(Cl)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C17H17ClO4S/c1-21-13-5-8-15(22-2)11(9-13)10-16(17(19)20)23-14-6-3-12(18)4-7-14/h3-9,16H,10H2,1-2H3,(H,19,20) |
| InChIKey | MOYMPBRVASTKFB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |