C22H19ClO3S — CID 133241369
3-(5-chloro-2-phenoxyphenyl)-2-(4-methylphenyl)sulfanylpropanoic acid (PubChem CID 133241369) has the molecular formula C22H19ClO3S and a molecular weight of 398.91 g/mol. Its IUPAC name is 3-(5-chloro-2-phenoxyphenyl)-2-(4-methylphenyl)sulfanylpropanoic acid.
| Compound Name | 3-(5-chloro-2-phenoxyphenyl)-2-(4-methylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 133241369 |
| Molecular Formula | C22H19ClO3S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-(5-chloro-2-phenoxyphenyl)-2-(4-methylphenyl)sulfanylpropanoic acid |
| SMILES | Cc1ccc(SC(Cc2cc(Cl)ccc2Oc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H19ClO3S/c1-15-7-10-19(11-8-15)27-21(22(24)25)14-16-13-17(23)9-12-20(16)26-18-5-3-2-4-6-18/h2-13,21H,14H2,1H3,(H,24,25) |
| InChIKey | DRQJCKPFUMLUPQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |