C16H15ClO2S — CID 100537924
(2S)-3-(5-chloro-2-methylphenyl)-2-phenylsulfanylpropanoic acid (PubChem CID 100537924) has the molecular formula C16H15ClO2S and a molecular weight of 306.81 g/mol. Its IUPAC name is (2S)-3-(5-chloro-2-methylphenyl)-2-phenylsulfanylpropanoic acid.
| Compound Name | (2S)-3-(5-chloro-2-methylphenyl)-2-phenylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 100537924 |
| Molecular Formula | C16H15ClO2S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | (2S)-3-(5-chloro-2-methylphenyl)-2-phenylsulfanylpropanoic acid |
| SMILES | Cc1ccc(Cl)cc1C[C@H](Sc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H15ClO2S/c1-11-7-8-13(17)9-12(11)10-15(16(18)19)20-14-5-3-2-4-6-14/h2-9,15H,10H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | KIULRCNDHVNVJS-HNNXBMFYSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |