C17H17ClO2S — CID 100536619
(2R)-3-(3-chloro-2-methylphenyl)-2-(4-methylphenyl)sulfanylpropanoic acid (PubChem CID 100536619) has the molecular formula C17H17ClO2S and a molecular weight of 320.84 g/mol. Its IUPAC name is (2R)-3-(3-chloro-2-methylphenyl)-2-(4-methylphenyl)sulfanylpropanoic acid.
| Compound Name | (2R)-3-(3-chloro-2-methylphenyl)-2-(4-methylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 100536619 |
| Molecular Formula | C17H17ClO2S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (2R)-3-(3-chloro-2-methylphenyl)-2-(4-methylphenyl)sulfanylpropanoic acid |
| SMILES | Cc1ccc(S[C@H](Cc2cccc(Cl)c2C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H17ClO2S/c1-11-6-8-14(9-7-11)21-16(17(19)20)10-13-4-3-5-15(18)12(13)2/h3-9,16H,10H2,1-2H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | NVPLKTUZVFVMMQ-MRXNPFEDSA-N |
| XLogP | 4.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |