C10H13NO2S — CID 64695641
3-amino-2-(4-methylphenyl)sulfanylpropanoic acid (PubChem CID 64695641) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 3-amino-2-(4-methylphenyl)sulfanylpropanoic acid.
| Compound Name | 3-amino-2-(4-methylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 64695641 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 3-amino-2-(4-methylphenyl)sulfanylpropanoic acid |
| SMILES | Cc1ccc(SC(CN)C(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO2S/c1-7-2-4-8(5-3-7)14-9(6-11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13) |
| InChIKey | IVAIRSYEIHNSFV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |