C18H20O2S2 — CID 102184120
methyl 2,3-bis[(4-methylphenyl)sulfanyl]propanoate (PubChem CID 102184120) has the molecular formula C18H20O2S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is methyl 2,3-bis[(4-methylphenyl)sulfanyl]propanoate.
| Compound Name | methyl 2,3-bis[(4-methylphenyl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 102184120 |
| Molecular Formula | C18H20O2S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl 2,3-bis[(4-methylphenyl)sulfanyl]propanoate |
| SMILES | COC(=O)C(CSc1ccc(C)cc1)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C18H20O2S2/c1-13-4-8-15(9-5-13)21-12-17(18(19)20-3)22-16-10-6-14(2)7-11-16/h4-11,17H,12H2,1-3H3 |
| InChIKey | DXANSCJAVYAFEG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |