methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate

C14H18O4S — CID 10564846

IUPACmethyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate
SMILESCOC(=O)C(CC1(C)OCCO1)Sc1ccccc1
InChIInChI=1S/C14H18O4S/c1-14(17-8-9-18-14)10-12(13(15)16-2)19-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3
InChIKeyQUGNYTAOAUSGAJ-UHFFFAOYSA-N
MW282.36 g/mol
LogP2.47
Rot. Bonds5

About methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate

methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate (PubChem CID 10564846) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate.

Molecular Properties

Compound Namemethyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate
PubChem CID10564846
Molecular FormulaC14H18O4S
Molecular Weight282.36 g/mol
Exact Mass282.09
IUPAC Namemethyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate
SMILESCOC(=O)C(CC1(C)OCCO1)Sc1ccccc1
InChIInChI=1S/C14H18O4S/c1-14(17-8-9-18-14)10-12(13(15)16-2)19-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3
InChIKeyQUGNYTAOAUSGAJ-UHFFFAOYSA-N
XLogP2.47
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.36
LogP ≤ 52.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate?
The IUPAC name of methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate (CID 10564846) is methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate.
What is the SMILES notation for methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate?
The canonical SMILES for methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate is COC(=O)C(CC1(C)OCCO1)Sc1ccccc1.
What is the InChIKey of methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate?
The InChIKey is QUGNYTAOAUSGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4S/c1-14(17-8-9-18-14)10-12(13(15)16-2)19-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3.
What are the key properties of methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate?
methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate has a molecular weight of 282.36 g/mol, XLogP of 2.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-methyl-1,3-dioxolan-2-yl)-2-phenylsulfanylpropanoate is sourced from PubChem (CID 10564846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).