C17H23NO3S — CID 11393087
ethyl 4-oxo-3-phenylsulfanyl-4-piperidin-1-ylbutanoate (PubChem CID 11393087) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is ethyl 4-oxo-3-phenylsulfanyl-4-piperidin-1-ylbutanoate.
| Compound Name | ethyl 4-oxo-3-phenylsulfanyl-4-piperidin-1-ylbutanoate |
|---|---|
| PubChem CID | 11393087 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | ethyl 4-oxo-3-phenylsulfanyl-4-piperidin-1-ylbutanoate |
| SMILES | CCOC(=O)CC(Sc1ccccc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H23NO3S/c1-2-21-16(19)13-15(22-14-9-5-3-6-10-14)17(20)18-11-7-4-8-12-18/h3,5-6,9-10,15H,2,4,7-8,11-13H2,1H3 |
| InChIKey | NHSNYKJRNTVELC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |