C17H17ClO3S — CID 100543923
(2S)-2-(4-chlorophenyl)sulfanyl-3-(2-ethoxyphenyl)propanoic acid (PubChem CID 100543923) has the molecular formula C17H17ClO3S and a molecular weight of 336.84 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)sulfanyl-3-(2-ethoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-(4-chlorophenyl)sulfanyl-3-(2-ethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 100543923 |
| Molecular Formula | C17H17ClO3S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)sulfanyl-3-(2-ethoxyphenyl)propanoic acid |
| SMILES | CCOc1ccccc1C[C@H](Sc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C17H17ClO3S/c1-2-21-15-6-4-3-5-12(15)11-16(17(19)20)22-14-9-7-13(18)8-10-14/h3-10,16H,2,11H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | YHCQCGLEWDBWHB-INIZCTEOSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |