C16H15ClO3S — CID 100547414
(2R)-3-(5-chloro-2-methoxyphenyl)-2-phenylsulfanylpropanoic acid (PubChem CID 100547414) has the molecular formula C16H15ClO3S and a molecular weight of 322.81 g/mol. Its IUPAC name is (2R)-3-(5-chloro-2-methoxyphenyl)-2-phenylsulfanylpropanoic acid.
| Compound Name | (2R)-3-(5-chloro-2-methoxyphenyl)-2-phenylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 100547414 |
| Molecular Formula | C16H15ClO3S |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (2R)-3-(5-chloro-2-methoxyphenyl)-2-phenylsulfanylpropanoic acid |
| SMILES | COc1ccc(Cl)cc1C[C@@H](Sc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H15ClO3S/c1-20-14-8-7-12(17)9-11(14)10-15(16(18)19)21-13-5-3-2-4-6-13/h2-9,15H,10H2,1H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | ZITFHHVFECHZJG-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |