C21H24O7 — CID 141111717
2-[4-[2-[4-(2-carboxy-2-hydroxyethyl)phenoxy]ethyl]phenoxy]-2-methylpropanoic acid (PubChem CID 141111717) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-[4-[2-[4-(2-carboxy-2-hydroxyethyl)phenoxy]ethyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[4-(2-carboxy-2-hydroxyethyl)phenoxy]ethyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 141111717 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[4-[2-[4-(2-carboxy-2-hydroxyethyl)phenoxy]ethyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(CCOc2ccc(CC(O)C(=O)O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H24O7/c1-21(2,20(25)26)28-17-9-3-14(4-10-17)11-12-27-16-7-5-15(6-8-16)13-18(22)19(23)24/h3-10,18,22H,11-13H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | RSEPYZRRZZSFAB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |