C14H21NO5 — CID 142975502
ethane;2-hydroxy-3-[4-[2-(methylamino)-2-oxoethoxy]phenyl]propanoic acid (PubChem CID 142975502) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is ethane;2-hydroxy-3-[4-[2-(methylamino)-2-oxoethoxy]phenyl]propanoic acid.
| Compound Name | ethane;2-hydroxy-3-[4-[2-(methylamino)-2-oxoethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142975502 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethane;2-hydroxy-3-[4-[2-(methylamino)-2-oxoethoxy]phenyl]propanoic acid |
| SMILES | CC.CNC(=O)COc1ccc(CC(O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO5.C2H6/c1-13-11(15)7-18-9-4-2-8(3-5-9)6-10(14)12(16)17;1-2/h2-5,10,14H,6-7H2,1H3,(H,13,15)(H,16,17);1-2H3 |
| InChIKey | FZNDYAQVARQQJU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |