C22H21FN2O4 — CID 24754074
2-[4-[2-[5-(4-fluorophenyl)pyrimidin-2-yl]oxyethyl]phenoxy]-2-methylpropanoic acid (PubChem CID 24754074) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[4-[2-[5-(4-fluorophenyl)pyrimidin-2-yl]oxyethyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[5-(4-fluorophenyl)pyrimidin-2-yl]oxyethyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 24754074 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-[4-[2-[5-(4-fluorophenyl)pyrimidin-2-yl]oxyethyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(CCOc2ncc(-c3ccc(F)cc3)cn2)cc1)C(=O)O |
| InChI | InChI=1S/C22H21FN2O4/c1-22(2,20(26)27)29-19-9-3-15(4-10-19)11-12-28-21-24-13-17(14-25-21)16-5-7-18(23)8-6-16/h3-10,13-14H,11-12H2,1-2H3,(H,26,27) |
| InChIKey | OLWLNHUQBWAFOT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |